ChemNet > CAS > 220461-83-6 4-(1H-pyrazol-1-yl)benzoyl chloride
220461-83-6 4-(1H-pyrazol-1-yl)benzoyl chloride
Nazwa produktu: |
4-(1H-pyrazol-1-yl)benzoyl chloride |
Synonimy |
4-pyrazol-1-ylbenzoyl chloride |
MF |
C10H7ClN2O |
Masie cząsteczkowej |
206.6284 |
InChI |
InChI=1/C10H7ClN2O/c11-10(14)8-2-4-9(5-3-8)13-7-1-6-12-13/h1-7H |
Nr CAS |
220461-83-6 |
Struktury molekularnej |
|
Gęstość |
1.303g/cm3 |
Temperatura topnienia |
118℃ |
Temperatura wrzenia |
319.861°C at 760 mmHg |
Współczynnik załamania |
1.624 |
Temperatura zapłonu |
147.247°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|